C19H21N7 — CID 58395252
3-[4-methyl-1-(pyrimidin-5-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58395252) has the molecular formula C19H21N7 and a molecular weight of 347.43 g/mol. Its IUPAC name is 3-[4-methyl-1-(pyrimidin-5-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[4-methyl-1-(pyrimidin-5-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58395252 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[4-methyl-1-(pyrimidin-5-ylmethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CC1(n2cnc3cnc4[nH]ccc4c32)CCN(Cc2cncnc2)CC1 |
| InChI | InChI=1S/C19H21N7/c1-19(3-6-25(7-4-19)11-14-8-20-12-21-9-14)26-13-24-16-10-23-18-15(17(16)26)2-5-22-18/h2,5,8-10,12-13H,3-4,6-7,11H2,1H3,(H,22,23) |
| InChIKey | WGENEAJVEJTRQC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |