C21H19N5 — CID 58395514
3-[2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]ethyl]benzonitrile (PubChem CID 58395514) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-[2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]ethyl]benzonitrile.
| Compound Name | 3-[2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 58395514 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[2-[3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclobutyl]ethyl]benzonitrile |
| SMILES | N#Cc1cccc(CCC2CC(n3cnc4cnc5[nH]ccc5c43)C2)c1 |
| InChI | InChI=1S/C21H19N5/c22-11-16-3-1-2-14(8-16)4-5-15-9-17(10-15)26-13-25-19-12-24-21-18(20(19)26)6-7-23-21/h1-3,6-8,12-13,15,17H,4-5,9-10H2,(H,23,24) |
| InChIKey | UQXSWEBSVLXVMR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |