C22H14F2N2O — CID 58404920
3-[2-(2,4-difluorophenyl)ethynyl]-5-methoxy-7-phenylimidazo[1,2-a]pyridine (PubChem CID 58404920) has the molecular formula C22H14F2N2O and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenyl)ethynyl]-5-methoxy-7-phenylimidazo[1,2-a]pyridine.
| Compound Name | 3-[2-(2,4-difluorophenyl)ethynyl]-5-methoxy-7-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 58404920 |
| Molecular Formula | C22H14F2N2O |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-[2-(2,4-difluorophenyl)ethynyl]-5-methoxy-7-phenylimidazo[1,2-a]pyridine |
| SMILES | COc1cc(-c2ccccc2)cc2ncc(C#Cc3ccc(F)cc3F)n12 |
| InChI | InChI=1S/C22H14F2N2O/c1-27-22-12-17(15-5-3-2-4-6-15)11-21-25-14-19(26(21)22)10-8-16-7-9-18(23)13-20(16)24/h2-7,9,11-14H,1H3 |
| InChIKey | OLGOEMQDTFCOGY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|