C23H36N6O3Si — CID 58405715
(7R)-7-ethyl-5-methyl-2-[2-oxo-2-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]ethyl]-8-propan-2-yl-7H-pteridin-6-one (PubChem CID 58405715) has the molecular formula C23H36N6O3Si and a molecular weight of 472.67 g/mol. Its IUPAC name is (7R)-7-ethyl-5-methyl-2-[2-oxo-2-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]ethyl]-8-propan-2-yl-7H-pteridin-6-one.
| Compound Name | (7R)-7-ethyl-5-methyl-2-[2-oxo-2-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]ethyl]-8-propan-2-yl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405715 |
| Molecular Formula | C23H36N6O3Si |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (7R)-7-ethyl-5-methyl-2-[2-oxo-2-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]ethyl]-8-propan-2-yl-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(CC(=O)c3ccnn3COCC[Si](C)(C)C)nc2N1C(C)C |
| InChI | InChI=1S/C23H36N6O3Si/c1-8-17-23(31)27(4)19-14-24-21(26-22(19)29(17)16(2)3)13-20(30)18-9-10-25-28(18)15-32-11-12-33(5,6)7/h9-10,14,16-17H,8,11-13,15H2,1-7H3/t17-/m1/s1 |
| InChIKey | CMIZRWJAXGSQOX-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|