C19H20N2 — CID 58409410
N-(2,6-dimethylphenyl)-2,4-dimethylquinolin-8-amine (PubChem CID 58409410) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2,4-dimethylquinolin-8-amine.
| Compound Name | N-(2,6-dimethylphenyl)-2,4-dimethylquinolin-8-amine |
|---|---|
| PubChem CID | 58409410 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2,4-dimethylquinolin-8-amine |
| SMILES | Cc1cc(C)c2cccc(Nc3c(C)cccc3C)c2n1 |
| InChI | InChI=1S/C19H20N2/c1-12-7-5-8-13(2)18(12)21-17-10-6-9-16-14(3)11-15(4)20-19(16)17/h5-11,21H,1-4H3 |
| InChIKey | WLRWLTGWANEATN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |