About (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane
(3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane (PubChem CID 58416612) has the molecular formula C13H24S2
and a molecular weight of 244.47 g/mol. Its IUPAC name is (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane.
Molecular Properties
| Compound Name | (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane |
| PubChem CID | 58416612 |
| Molecular Formula | C13H24S2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane |
| SMILES | C=C(CCCC[C@@H]1CCSS1)C(C)(C)C |
| InChI | InChI=1S/C13H24S2/c1-11(13(2,3)4)7-5-6-8-12-9-10-14-15-12/h12H,1,5-10H2,2-4H3/t12-/m1/s1 |
| InChIKey | GMMUMEMKEWGSHY-GFCCVEGCSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane?
The IUPAC name of (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane (CID 58416612) is (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane.
What is the SMILES notation for (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane?
The canonical SMILES for (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane is C=C(CCCC[C@@H]1CCSS1)C(C)(C)C.
What is the InChIKey of (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane?
The InChIKey is GMMUMEMKEWGSHY-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H24S2/c1-11(13(2,3)4)7-5-6-8-12-9-10-14-15-12/h12H,1,5-10H2,2-4H3/t12-/m1/s1.
What are the key properties of (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane?
(3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane has a molecular weight of 244.47 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(6,6-dimethyl-5-methylideneheptyl)dithiolane is sourced from PubChem (CID 58416612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).