C35H41N5O5S2 — CID 58416962
1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[cyclopropyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]-9-hydroxy-7-oxo-1-phenylnonan-2-yl]carbamate (PubChem CID 58416962) has the molecular formula C35H41N5O5S2 and a molecular weight of 675.88 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[cyclopropyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]-9-hydroxy-7-oxo-1-phenylnonan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[cyclopropyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]-9-hydroxy-7-oxo-1-phenylnonan-2-yl]carbamate |
|---|---|
| PubChem CID | 58416962 |
| Molecular Formula | C35H41N5O5S2 |
| Molecular Weight | 675.88 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2R,5R,8S)-5-benzyl-8-[[cyclopropyl(1,3-thiazol-5-ylmethyl)carbamoyl]amino]-9-hydroxy-7-oxo-1-phenylnonan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CCC(CC(=O)[C@H](CO)NC(=O)N(Cc1cncs1)C1CC1)Cc1ccccc1)Cc1ccccc1)OCc1cncs1 |
| InChI | InChI=1S/C35H41N5O5S2/c41-21-32(39-34(43)40(29-13-14-29)20-30-18-36-23-46-30)33(42)17-27(15-25-7-3-1-4-8-25)11-12-28(16-26-9-5-2-6-10-26)38-35(44)45-22-31-19-37-24-47-31/h1-10,18-19,23-24,27-29,32,41H,11-17,20-22H2,(H,38,44)(H,39,43)/t27?,28-,32+/m1/s1 |
| InChIKey | VZICYNBNUFJBQU-HMXQKIDWSA-N |
| XLogP | 5.77 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |