C12H26Si — CID 58427049
1,1-dimethyl-3,4-di(propan-2-yl)silolane (PubChem CID 58427049) has the molecular formula C12H26Si and a molecular weight of 198.43 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-di(propan-2-yl)silolane.
| Compound Name | 1,1-dimethyl-3,4-di(propan-2-yl)silolane |
|---|---|
| PubChem CID | 58427049 |
| Molecular Formula | C12H26Si |
| Molecular Weight | 198.43 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1,1-dimethyl-3,4-di(propan-2-yl)silolane |
| SMILES | CC(C)C1C[Si](C)(C)CC1C(C)C |
| InChI | InChI=1S/C12H26Si/c1-9(2)11-7-13(5,6)8-12(11)10(3)4/h9-12H,7-8H2,1-6H3 |
| InChIKey | ICWZTESGYHJNKB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|