C13H14ClNO3 — CID 58433526
(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoic acid (PubChem CID 58433526) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is (2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoic acid.
| Compound Name | (2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 58433526 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoic acid |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)O)[C@H](C)O)c(C)c1Cl |
| InChI | InChI=1S/C13H14ClNO3/c1-7-9(4-5-11(15-3)12(7)14)6-10(8(2)16)13(17)18/h4-5,8,10,16H,6H2,1-2H3,(H,17,18)/t8-,10+/m0/s1 |
| InChIKey | LPYIRGBONDWMGI-WCBMZHEXSA-N |
| XLogP | 2.82 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|