C20H19ClFN3O3 — CID 58433719
N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluorobenzohydrazide (PubChem CID 58433719) has the molecular formula C20H19ClFN3O3 and a molecular weight of 403.84 g/mol. Its IUPAC name is N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluorobenzohydrazide.
| Compound Name | N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluorobenzohydrazide |
|---|---|
| PubChem CID | 58433719 |
| Molecular Formula | C20H19ClFN3O3 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluorobenzohydrazide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)NNC(=O)c2cccc(F)c2)[C@H](C)O)c(C)c1Cl |
| InChI | InChI=1S/C20H19ClFN3O3/c1-11-13(7-8-17(23-3)18(11)21)10-16(12(2)26)20(28)25-24-19(27)14-5-4-6-15(22)9-14/h4-9,12,16,26H,10H2,1-2H3,(H,24,27)(H,25,28)/t12-,16+/m0/s1 |
| InChIKey | ZZNBLMWDEGQRLO-BLLLJJGKSA-N |
| XLogP | 3.34 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|