C20H19ClFN3O4 — CID 58433514
N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluoro-4-hydroxybenzohydrazide (PubChem CID 58433514) has the molecular formula C20H19ClFN3O4 and a molecular weight of 419.84 g/mol. Its IUPAC name is N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluoro-4-hydroxybenzohydrazide.
| Compound Name | N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluoro-4-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 58433514 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N'-[(2R,3S)-2-[(3-chloro-4-isocyano-2-methylphenyl)methyl]-3-hydroxybutanoyl]-3-fluoro-4-hydroxybenzohydrazide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)NNC(=O)c2ccc(O)c(F)c2)[C@H](C)O)c(C)c1Cl |
| InChI | InChI=1S/C20H19ClFN3O4/c1-10-12(4-6-16(23-3)18(10)21)8-14(11(2)26)20(29)25-24-19(28)13-5-7-17(27)15(22)9-13/h4-7,9,11,14,26-27H,8H2,1-2H3,(H,24,28)(H,25,29)/t11-,14+/m0/s1 |
| InChIKey | XOHQLECRSBRMEM-SMDDNHRTSA-N |
| XLogP | 3.04 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|