C20H31N3O3 — CID 58434448
1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-7-phenoxyheptane-2,6-diol (PubChem CID 58434448) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-7-phenoxyheptane-2,6-diol.
| Compound Name | 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-7-phenoxyheptane-2,6-diol |
|---|---|
| PubChem CID | 58434448 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 1-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-yl)-7-phenoxyheptane-2,6-diol |
| SMILES | OC(CCCC(O)CN1CCCN2CCCN=C21)COc1ccccc1 |
| InChI | InChI=1S/C20H31N3O3/c24-17(15-23-14-6-13-22-12-5-11-21-20(22)23)7-4-8-18(25)16-26-19-9-2-1-3-10-19/h1-3,9-10,17-18,24-25H,4-8,11-16H2 |
| InChIKey | FFDKERLEVZMEIY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |