C12H18F2O6S2 — CID 58436039
1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 58436039) has the molecular formula C12H18F2O6S2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 58436039 |
| Molecular Formula | C12H18F2O6S2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-[[2,2-difluoro-2-(trioxidanylsulfanyl)ethyl]sulfonylmethyl]-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)CC(F)(F)SOOO)C(=O)C2 |
| InChI | InChI=1S/C12H18F2O6S2/c1-10(2)8-3-4-11(10,9(15)5-8)6-22(17,18)7-12(13,14)21-20-19-16/h8,16H,3-7H2,1-2H3 |
| InChIKey | NUKJPBMBQNBRAP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|