C36H67N5O6S — CID 58441590
N'-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-N-[4-[tert-butyl(methyl)amino]butyl]pentanediamide (PubChem CID 58441590) has the molecular formula C36H67N5O6S and a molecular weight of 698.03 g/mol. Its IUPAC name is N'-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-N-[4-[tert-butyl(methyl)amino]butyl]pentanediamide.
| Compound Name | N'-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-N-[4-[tert-butyl(methyl)amino]butyl]pentanediamide |
|---|---|
| PubChem CID | 58441590 |
| Molecular Formula | C36H67N5O6S |
| Molecular Weight | 698.03 g/mol |
| Exact Mass | 697.48 |
| IUPAC Name | N'-[3-[2-[2-[3-[5-[(3aS,4S,6aR)-2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]-N-[4-[tert-butyl(methyl)amino]butyl]pentanediamide |
| SMILES | C=C1C[C@H]2[C@H](CS[C@H]2CCCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCC(=O)NCCCCN(C)C(C)(C)C)N1 |
| InChI | InChI=1S/C36H67N5O6S/c1-29-27-30-31(40-29)28-48-32(30)13-6-7-14-33(42)38-18-11-21-45-23-25-47-26-24-46-22-12-19-39-35(44)16-10-15-34(43)37-17-8-9-20-41(5)36(2,3)4/h30-32,40H,1,6-28H2,2-5H3,(H,37,43)(H,38,42)(H,39,44)/t30-,31-,32-/m0/s1 |
| InChIKey | INFMUWDZMDVXFA-CPCREDONSA-N |
| XLogP | 4.01 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.03 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|