C15H25NOS — CID 159377774
2-methyl-7-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl)heptan-3-one (PubChem CID 159377774) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 2-methyl-7-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl)heptan-3-one.
| Compound Name | 2-methyl-7-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl)heptan-3-one |
|---|---|
| PubChem CID | 159377774 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-methyl-7-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-4-yl)heptan-3-one |
| SMILES | C=C1CC2C(CSC2CCCCC(=O)C(C)C)N1 |
| InChI | InChI=1S/C15H25NOS/c1-10(2)14(17)6-4-5-7-15-12-8-11(3)16-13(12)9-18-15/h10,12-13,15-16H,3-9H2,1-2H3 |
| InChIKey | LKNMVJKEIDRUOW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|