C23H28IrN2O2-2 — CID 58444372
8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-2-yl)-7H-quinolin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 58444372) has the molecular formula C23H28IrN2O2-2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-2-yl)-7H-quinolin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-2-yl)-7H-quinolin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 58444372 |
| Molecular Formula | C23H28IrN2O2-2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-2-yl)-7H-quinolin-7-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccc2cccnc2c1C1CCC2CCCCC2[N-]1 |
| InChI | InChI=1S/C18H20N2.C5H8O2.Ir/c1-2-9-16-13(5-1)10-11-17(20-16)15-8-3-6-14-7-4-12-19-18(14)15;1-4(6)3-5(2)7;/h3-4,6-7,12-13,16-17H,1-2,5,9-11H2;3,6H,1-2H3;/q-2;;/b;4-3-; |
| InChIKey | RQQKOCIKNNCFDB-LWFKIUJUSA-N |
| XLogP | 5.84 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|