C31H34F2N2O2 — CID 58452976
butyl N-[(4S,10S)-4,10-bis(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate (PubChem CID 58452976) has the molecular formula C31H34F2N2O2 and a molecular weight of 504.62 g/mol. Its IUPAC name is butyl N-[(4S,10S)-4,10-bis(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate.
| Compound Name | butyl N-[(4S,10S)-4,10-bis(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
|---|---|
| PubChem CID | 58452976 |
| Molecular Formula | C31H34F2N2O2 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | butyl N-[(4S,10S)-4,10-bis(4-fluorophenyl)-4,10-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1cc2c3c(c1)[C@](C)(c1ccc(F)cc1)CCN3CC[C@@]2(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H34F2N2O2/c1-4-5-18-37-29(36)34-25-19-26-28-27(20-25)31(3,22-8-12-24(33)13-9-22)15-17-35(28)16-14-30(26,2)21-6-10-23(32)11-7-21/h6-13,19-20H,4-5,14-18H2,1-3H3,(H,34,36)/t30-,31-/m0/s1 |
| InChIKey | BXRWLXMDZKAZJO-CONSDPRKSA-N |
| XLogP | 7.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|