C26H24ClN5O6 — CID 58457067
(4R,6S,7S)-N-benzyl-17-chloro-4,6-dimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-13-carboxamide (PubChem CID 58457067) has the molecular formula C26H24ClN5O6 and a molecular weight of 537.96 g/mol. Its IUPAC name is (4R,6S,7S)-N-benzyl-17-chloro-4,6-dimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-13-carboxamide.
| Compound Name | (4R,6S,7S)-N-benzyl-17-chloro-4,6-dimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-13-carboxamide |
|---|---|
| PubChem CID | 58457067 |
| Molecular Formula | C26H24ClN5O6 |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (4R,6S,7S)-N-benzyl-17-chloro-4,6-dimethyl-2',4',6'-trioxospiro[5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene-8,3'-piperidine]-13-carboxamide |
| SMILES | C[C@@H]1CN2c3c(nc4c(C(=O)NCc5ccccc5)noc4c3Cl)CC3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C26H24ClN5O6/c1-12-11-32-21-15(9-26(23(32)13(2)37-12)16(33)8-17(34)30-25(26)36)29-19-20(31-38-22(19)18(21)27)24(35)28-10-14-6-4-3-5-7-14/h3-7,12-13,23H,8-11H2,1-2H3,(H,28,35)(H,30,34,36)/t12-,13+,23-,26?/m1/s1 |
| InChIKey | BQLSTNNYHHAFMI-PFGWLXJASA-N |
| XLogP | 1.95 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|