C20H26N2O — CID 58465460
4-[2,6-bis(dimethylamino)phenyl]-1-phenylbutan-2-one (PubChem CID 58465460) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-[2,6-bis(dimethylamino)phenyl]-1-phenylbutan-2-one.
| Compound Name | 4-[2,6-bis(dimethylamino)phenyl]-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 58465460 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 4-[2,6-bis(dimethylamino)phenyl]-1-phenylbutan-2-one |
| SMILES | CN(C)c1cccc(N(C)C)c1CCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-21(2)19-11-8-12-20(22(3)4)18(19)14-13-17(23)15-16-9-6-5-7-10-16/h5-12H,13-15H2,1-4H3 |
| InChIKey | LJSANQZFMLEEFS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |