C11H25N2O3+ — CID 58468438
[(E)-11-amino-2,4,10-trihydroxyundec-8-enyl]azanium (PubChem CID 58468438) has the molecular formula C11H25N2O3+ and a molecular weight of 233.33 g/mol. Its IUPAC name is [(E)-11-amino-2,4,10-trihydroxyundec-8-enyl]azanium.
| Compound Name | [(E)-11-amino-2,4,10-trihydroxyundec-8-enyl]azanium |
|---|---|
| PubChem CID | 58468438 |
| Molecular Formula | C11H25N2O3+ |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | [(E)-11-amino-2,4,10-trihydroxyundec-8-enyl]azanium |
| SMILES | NCC(O)/C=C/CCCC(O)CC(O)C[NH3+] |
| InChI | InChI=1S/C11H24N2O3/c12-7-10(15)5-3-1-2-4-9(14)6-11(16)8-13/h3,5,9-11,14-16H,1-2,4,6-8,12-13H2/p+1/b5-3+ |
| InChIKey | IJLIRFIINVIXNE-HWKANZROSA-O |
| XLogP | -1.61 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|