C5H10NO+ — CID 58468457
[(2E)-4-hydroxypenta-2,4-dienyl]azanium (PubChem CID 58468457) has the molecular formula C5H10NO+ and a molecular weight of 100.14 g/mol. Its IUPAC name is [(2E)-4-hydroxypenta-2,4-dienyl]azanium.
| Compound Name | [(2E)-4-hydroxypenta-2,4-dienyl]azanium |
|---|---|
| PubChem CID | 58468457 |
| Molecular Formula | C5H10NO+ |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.08 |
| IUPAC Name | [(2E)-4-hydroxypenta-2,4-dienyl]azanium |
| SMILES | C=C(O)/C=C/C[NH3+] |
| InChI | InChI=1S/C5H9NO/c1-5(7)3-2-4-6/h2-3,7H,1,4,6H2/p+1/b3-2+ |
| InChIKey | DBJYAJODVVWAMD-NSCUHMNNSA-O |
| XLogP | -0.14 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|