C26H19FO7 — CID 58471607
[2-fluoro-4-[(E)-3-oxo-3-(prop-2-enoyloxymethoxy)prop-1-enyl]phenyl] 4-(4-oxohex-5-en-1-ynyl)benzoate (PubChem CID 58471607) has the molecular formula C26H19FO7 and a molecular weight of 462.43 g/mol. Its IUPAC name is [2-fluoro-4-[(E)-3-oxo-3-(prop-2-enoyloxymethoxy)prop-1-enyl]phenyl] 4-(4-oxohex-5-en-1-ynyl)benzoate.
| Compound Name | [2-fluoro-4-[(E)-3-oxo-3-(prop-2-enoyloxymethoxy)prop-1-enyl]phenyl] 4-(4-oxohex-5-en-1-ynyl)benzoate |
|---|---|
| PubChem CID | 58471607 |
| Molecular Formula | C26H19FO7 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [2-fluoro-4-[(E)-3-oxo-3-(prop-2-enoyloxymethoxy)prop-1-enyl]phenyl] 4-(4-oxohex-5-en-1-ynyl)benzoate |
| SMILES | C=CC(=O)CC#Cc1ccc(C(=O)Oc2ccc(/C=C/C(=O)OCOC(=O)C=C)cc2F)cc1 |
| InChI | InChI=1S/C26H19FO7/c1-3-21(28)7-5-6-18-8-12-20(13-9-18)26(31)34-23-14-10-19(16-22(23)27)11-15-25(30)33-17-32-24(29)4-2/h3-4,8-16H,1-2,7,17H2/b15-11+ |
| InChIKey | ZFXGHVZNMCEIFZ-RVDMUPIBSA-N |
| XLogP | 3.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|