C35H25FO6 — CID 58471662
[4-[4-(prop-2-enoyloxymethoxy)phenyl]phenyl] 4-[2-fluoro-4-(4-oxohex-5-en-1-ynyl)phenyl]benzoate (PubChem CID 58471662) has the molecular formula C35H25FO6 and a molecular weight of 560.58 g/mol. Its IUPAC name is [4-[4-(prop-2-enoyloxymethoxy)phenyl]phenyl] 4-[2-fluoro-4-(4-oxohex-5-en-1-ynyl)phenyl]benzoate.
| Compound Name | [4-[4-(prop-2-enoyloxymethoxy)phenyl]phenyl] 4-[2-fluoro-4-(4-oxohex-5-en-1-ynyl)phenyl]benzoate |
|---|---|
| PubChem CID | 58471662 |
| Molecular Formula | C35H25FO6 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [4-[4-(prop-2-enoyloxymethoxy)phenyl]phenyl] 4-[2-fluoro-4-(4-oxohex-5-en-1-ynyl)phenyl]benzoate |
| SMILES | C=CC(=O)CC#Cc1ccc(-c2ccc(C(=O)Oc3ccc(-c4ccc(OCOC(=O)C=C)cc4)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C35H25FO6/c1-3-29(37)7-5-6-24-8-21-32(33(36)22-24)27-9-11-28(12-10-27)35(39)42-31-19-15-26(16-20-31)25-13-17-30(18-14-25)40-23-41-34(38)4-2/h3-4,8-22H,1-2,7,23H2 |
| InChIKey | MFCMXLUTFQPMRO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|