C26H22O6 — CID 58471716
prop-2-enoyloxymethyl (E)-3-[4-[[4-(4-oxohex-5-en-1-ynyl)phenyl]methoxy]phenyl]prop-2-enoate (PubChem CID 58471716) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is prop-2-enoyloxymethyl (E)-3-[4-[[4-(4-oxohex-5-en-1-ynyl)phenyl]methoxy]phenyl]prop-2-enoate.
| Compound Name | prop-2-enoyloxymethyl (E)-3-[4-[[4-(4-oxohex-5-en-1-ynyl)phenyl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58471716 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | prop-2-enoyloxymethyl (E)-3-[4-[[4-(4-oxohex-5-en-1-ynyl)phenyl]methoxy]phenyl]prop-2-enoate |
| SMILES | C=CC(=O)CC#Cc1ccc(COc2ccc(/C=C/C(=O)OCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C26H22O6/c1-3-23(27)7-5-6-20-8-10-22(11-9-20)18-30-24-15-12-21(13-16-24)14-17-26(29)32-19-31-25(28)4-2/h3-4,8-17H,1-2,7,18-19H2/b17-14+ |
| InChIKey | KBFLNZDNWALMRP-SAPNQHFASA-N |
| XLogP | 4.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|