C24H27ClN4O4 — CID 58478327
1-butyl-6-chloro-3-[4-(2,5-dioxo-3-phenylpyrrolidin-1-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 58478327) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 1-butyl-6-chloro-3-[4-(2,5-dioxo-3-phenylpyrrolidin-1-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-chloro-3-[4-(2,5-dioxo-3-phenylpyrrolidin-1-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58478327 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-butyl-6-chloro-3-[4-(2,5-dioxo-3-phenylpyrrolidin-1-yl)butyl]-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCn1c2c(c(=O)n(CCCCN3C(=O)CC(c4ccccc4)C3=O)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C24H27ClN4O4/c1-2-3-11-28-21-18(14-19(25)26-21)23(32)29(24(28)33)13-8-7-12-27-20(30)15-17(22(27)31)16-9-5-4-6-10-16/h4-6,9-10,17H,2-3,7-8,11-15H2,1H3 |
| InChIKey | QAEDXOIHZVWZNU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|