C14H27NO3 — CID 58491825
(2S)-N-tert-butyl-2-hydroxy-7,7-dimethyl-6-oxooctanamide (PubChem CID 58491825) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-hydroxy-7,7-dimethyl-6-oxooctanamide.
| Compound Name | (2S)-N-tert-butyl-2-hydroxy-7,7-dimethyl-6-oxooctanamide |
|---|---|
| PubChem CID | 58491825 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (2S)-N-tert-butyl-2-hydroxy-7,7-dimethyl-6-oxooctanamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](O)CCCC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NO3/c1-13(2,3)11(17)9-7-8-10(16)12(18)15-14(4,5)6/h10,16H,7-9H2,1-6H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | BIQWYUOSSJOWNJ-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |