C14H21NO6S — CID 58492876
1-O-tert-butyl 2-O-[(5-oxo-1,3-oxathiolan-2-yl)methyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 58492876) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(5-oxo-1,3-oxathiolan-2-yl)methyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(5-oxo-1,3-oxathiolan-2-yl)methyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58492876 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(5-oxo-1,3-oxathiolan-2-yl)methyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OCC1OC(=O)CS1 |
| InChI | InChI=1S/C14H21NO6S/c1-14(2,3)21-13(18)15-6-4-5-9(15)12(17)19-7-11-20-10(16)8-22-11/h9,11H,4-8H2,1-3H3 |
| InChIKey | IBEOQSCPNWXSNV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|