C9H9NO5 — CID 58498465
(2,5-dioxopyrrolidin-1-yl) (E)-4-oxopent-2-enoate (PubChem CID 58498465) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E)-4-oxopent-2-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 58498465 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E)-4-oxopent-2-enoate |
| SMILES | CC(=O)/C=C/C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H9NO5/c1-6(11)2-5-9(14)15-10-7(12)3-4-8(10)13/h2,5H,3-4H2,1H3/b5-2+ |
| InChIKey | KGWZPQNLFOZTII-GORDUTHDSA-N |
| XLogP | -0.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|