C13H9ClN4 — CID 58499150
6-chloro-N-phenylpyrido[2,3-d]pyrimidin-2-amine (PubChem CID 58499150) has the molecular formula C13H9ClN4 and a molecular weight of 256.70 g/mol. Its IUPAC name is 6-chloro-N-phenylpyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-chloro-N-phenylpyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58499150 |
| Molecular Formula | C13H9ClN4 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 6-chloro-N-phenylpyrido[2,3-d]pyrimidin-2-amine |
| SMILES | Clc1cnc2nc(Nc3ccccc3)ncc2c1 |
| InChI | InChI=1S/C13H9ClN4/c14-10-6-9-7-16-13(18-12(9)15-8-10)17-11-4-2-1-3-5-11/h1-8H,(H,15,16,17,18) |
| InChIKey | SLVNAMOWABITCF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |