C28H28F5NO4 — CID 58512912
ethyl 2-hydroxy-7,7-dimethyl-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-4-(4-phenylphenyl)-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 58512912) has the molecular formula C28H28F5NO4 and a molecular weight of 537.53 g/mol. Its IUPAC name is ethyl 2-hydroxy-7,7-dimethyl-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-4-(4-phenylphenyl)-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 2-hydroxy-7,7-dimethyl-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-4-(4-phenylphenyl)-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 58512912 |
| Molecular Formula | C28H28F5NO4 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | ethyl 2-hydroxy-7,7-dimethyl-5-oxo-2-(1,1,2,2,2-pentafluoroethyl)-4-(4-phenylphenyl)-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccc(-c3ccccc3)cc2)C2=C(CC(C)(C)CC2=O)NC1(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H28F5NO4/c1-4-38-24(36)23-21(18-12-10-17(11-13-18)16-8-6-5-7-9-16)22-19(14-25(2,3)15-20(22)35)34-26(23,37)27(29,30)28(31,32)33/h5-13,21,23,34,37H,4,14-15H2,1-3H3 |
| InChIKey | JOIRHRRWQSZEFB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|