C17H18Br2N2 — CID 58516883
4,12-dibromo-8-hexyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 58516883) has the molecular formula C17H18Br2N2 and a molecular weight of 410.15 g/mol. Its IUPAC name is 4,12-dibromo-8-hexyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4,12-dibromo-8-hexyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 58516883 |
| Molecular Formula | C17H18Br2N2 |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 4,12-dibromo-8-hexyl-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCCCCCC1c2ccc(Br)nc2-c2nc(Br)ccc21 |
| InChI | InChI=1S/C17H18Br2N2/c1-2-3-4-5-6-11-12-7-9-14(18)20-16(12)17-13(11)8-10-15(19)21-17/h7-11H,2-6H2,1H3 |
| InChIKey | NIRSTXYAECQUMX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|