C13H6N4 — CID 58517472
5-isocyanoimidazo[2,1-a]isoquinoline-8-carbonitrile (PubChem CID 58517472) has the molecular formula C13H6N4 and a molecular weight of 218.22 g/mol. Its IUPAC name is 5-isocyanoimidazo[2,1-a]isoquinoline-8-carbonitrile.
| Compound Name | 5-isocyanoimidazo[2,1-a]isoquinoline-8-carbonitrile |
|---|---|
| PubChem CID | 58517472 |
| Molecular Formula | C13H6N4 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-isocyanoimidazo[2,1-a]isoquinoline-8-carbonitrile |
| SMILES | [C-]#[N+]c1cc2cc(C#N)ccc2c2nccn12 |
| InChI | InChI=1S/C13H6N4/c1-15-12-7-10-6-9(8-14)2-3-11(10)13-16-4-5-17(12)13/h2-7H |
| InChIKey | AOJUMEMFYODFQP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|