C10H8N4 — CID 58517629
5-methyl-2H-triazolo[4,5-h]quinoline (PubChem CID 58517629) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-methyl-2H-triazolo[4,5-h]quinoline.
| Compound Name | 5-methyl-2H-triazolo[4,5-h]quinoline |
|---|---|
| PubChem CID | 58517629 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-methyl-2H-triazolo[4,5-h]quinoline |
| SMILES | Cc1cc2n[nH]nc2c2ncccc12 |
| InChI | InChI=1S/C10H8N4/c1-6-5-8-10(13-14-12-8)9-7(6)3-2-4-11-9/h2-5H,1H3,(H,12,13,14) |
| InChIKey | GLZJJZHRAILVOT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |