C12H9IrN2- — CID 58517724
iridium;6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide (PubChem CID 58517724) has the molecular formula C12H9IrN2- and a molecular weight of 373.44 g/mol. Its IUPAC name is iridium;6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide.
| Compound Name | iridium;6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide |
|---|---|
| PubChem CID | 58517724 |
| Molecular Formula | C12H9IrN2- |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | iridium;6-methyl-10H-imidazo[2,1-a]isoquinolin-10-ide |
| SMILES | Cc1cn2ccnc2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C12H9N2.Ir/c1-9-8-14-7-6-13-12(14)11-5-3-2-4-10(9)11;/h2-4,6-8H,1H3;/q-1; |
| InChIKey | ZNFXUJKTTZECDF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|