C47H43N3O6S — CID 58520574
1'-[[4-[(3,3-dimethyl-8'-methylsulfanyl-6'-nitrospiro[1H-indene-2,2'-chromene]-1-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 58520574) has the molecular formula C47H43N3O6S and a molecular weight of 777.94 g/mol. Its IUPAC name is 1'-[[4-[(3,3-dimethyl-8'-methylsulfanyl-6'-nitrospiro[1H-indene-2,2'-chromene]-1-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[[4-[(3,3-dimethyl-8'-methylsulfanyl-6'-nitrospiro[1H-indene-2,2'-chromene]-1-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 58520574 |
| Molecular Formula | C47H43N3O6S |
| Molecular Weight | 777.94 g/mol |
| Exact Mass | 777.29 |
| IUPAC Name | 1'-[[4-[(3,3-dimethyl-8'-methylsulfanyl-6'-nitrospiro[1H-indene-2,2'-chromene]-1-yl)methyl]phenyl]methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CSc1cc([N+](=O)[O-])cc2c1OC1(C=C2)C(Cc2ccc(CN3c4ccccc4C(C)(C)C34C=Cc3cc([N+](=O)[O-])cc(C)c3O4)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C47H43N3O6S/c1-29-23-34(49(51)52)25-32-20-22-47(56-42(29)32)45(4,5)38-13-9-10-14-40(38)48(47)28-31-17-15-30(16-18-31)24-39-36-11-7-8-12-37(36)44(2,3)46(39)21-19-33-26-35(50(53)54)27-41(57-6)43(33)55-46/h7-23,25-27,39H,24,28H2,1-6H3 |
| InChIKey | CIPGARFSKIHVFS-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.94 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|