C37H30N2O2S — CID 88884176
3',3'-dimethyl-6-nitroso-1'-[[4-(4-phenylphenyl)phenyl]methyl]spiro[chromene-2,2'-indole]-8-thiol (PubChem CID 88884176) has the molecular formula C37H30N2O2S and a molecular weight of 566.73 g/mol. Its IUPAC name is 3',3'-dimethyl-6-nitroso-1'-[[4-(4-phenylphenyl)phenyl]methyl]spiro[chromene-2,2'-indole]-8-thiol.
| Compound Name | 3',3'-dimethyl-6-nitroso-1'-[[4-(4-phenylphenyl)phenyl]methyl]spiro[chromene-2,2'-indole]-8-thiol |
|---|---|
| PubChem CID | 88884176 |
| Molecular Formula | C37H30N2O2S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 3',3'-dimethyl-6-nitroso-1'-[[4-(4-phenylphenyl)phenyl]methyl]spiro[chromene-2,2'-indole]-8-thiol |
| SMILES | CC1(C)c2ccccc2N(Cc2ccc(-c3ccc(-c4ccccc4)cc3)cc2)C12C=Cc1cc(N=O)cc(S)c1O2 |
| InChI | InChI=1S/C37H30N2O2S/c1-36(2)32-10-6-7-11-33(32)39(37(36)21-20-30-22-31(38-40)23-34(42)35(30)41-37)24-25-12-14-27(15-13-25)29-18-16-28(17-19-29)26-8-4-3-5-9-26/h3-23,42H,24H2,1-2H3 |
| InChIKey | FKBYKCDGAMASAU-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|