C32H28N2O3S — CID 70673443
3',3'-dimethyl-8-methylsulfanyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] (PubChem CID 70673443) has the molecular formula C32H28N2O3S and a molecular weight of 520.65 g/mol. Its IUPAC name is 3',3'-dimethyl-8-methylsulfanyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole].
| Compound Name | 3',3'-dimethyl-8-methylsulfanyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 70673443 |
| Molecular Formula | C32H28N2O3S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3',3'-dimethyl-8-methylsulfanyl-6-nitro-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole] |
| SMILES | CSc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(-c3ccccc3)cc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C32H28N2O3S/c1-31(2)27-11-7-8-12-28(27)33(21-22-13-15-24(16-14-22)23-9-5-4-6-10-23)32(31)18-17-25-19-26(34(35)36)20-29(38-3)30(25)37-32/h4-20H,21H2,1-3H3 |
| InChIKey | AJEJINLFHUKYAK-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|