C21H16ClF3N2O3 — CID 58525526
6-[3-(3-chlorophenyl)-2-oxopropyl]-N-hydroxy-8-methyl-4-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 58525526) has the molecular formula C21H16ClF3N2O3 and a molecular weight of 436.82 g/mol. Its IUPAC name is 6-[3-(3-chlorophenyl)-2-oxopropyl]-N-hydroxy-8-methyl-4-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | 6-[3-(3-chlorophenyl)-2-oxopropyl]-N-hydroxy-8-methyl-4-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 58525526 |
| Molecular Formula | C21H16ClF3N2O3 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 6-[3-(3-chlorophenyl)-2-oxopropyl]-N-hydroxy-8-methyl-4-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | Cc1cc(CC(=O)Cc2cccc(Cl)c2)cc2c(C(F)(F)F)c(C(=O)NO)cnc12 |
| InChI | InChI=1S/C21H16ClF3N2O3/c1-11-5-13(8-15(28)7-12-3-2-4-14(22)6-12)9-16-18(21(23,24)25)17(20(29)27-30)10-26-19(11)16/h2-6,9-10,30H,7-8H2,1H3,(H,27,29) |
| InChIKey | XOQDKTQTWDKJPB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|