C16H27NO9 — CID 58535243
2-[1-(2-carboxyethylamino)oxy-1-oxopropan-2-yl]-5-(2-methoxyethoxy)-4,4-dimethyl-5-oxopentanoic acid (PubChem CID 58535243) has the molecular formula C16H27NO9 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[1-(2-carboxyethylamino)oxy-1-oxopropan-2-yl]-5-(2-methoxyethoxy)-4,4-dimethyl-5-oxopentanoic acid.
| Compound Name | 2-[1-(2-carboxyethylamino)oxy-1-oxopropan-2-yl]-5-(2-methoxyethoxy)-4,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58535243 |
| Molecular Formula | C16H27NO9 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[1-(2-carboxyethylamino)oxy-1-oxopropan-2-yl]-5-(2-methoxyethoxy)-4,4-dimethyl-5-oxopentanoic acid |
| SMILES | COCCOC(=O)C(C)(C)CC(C(=O)O)C(C)C(=O)ONCCC(=O)O |
| InChI | InChI=1S/C16H27NO9/c1-10(14(22)26-17-6-5-12(18)19)11(13(20)21)9-16(2,3)15(23)25-8-7-24-4/h10-11,17H,5-9H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | VSRGLWJAIAOJNU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|