C29H32F2N2O4 — CID 58536971
4-[bis(3-fluorophenyl)-methoxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide (PubChem CID 58536971) has the molecular formula C29H32F2N2O4 and a molecular weight of 510.58 g/mol. Its IUPAC name is 4-[bis(3-fluorophenyl)-methoxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide.
| Compound Name | 4-[bis(3-fluorophenyl)-methoxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58536971 |
| Molecular Formula | C29H32F2N2O4 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 4-[bis(3-fluorophenyl)-methoxymethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]-N-methylbenzamide |
| SMILES | COC(c1ccc(C(=O)N(C)CCCCCCC(=O)NO)cc1)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C29H32F2N2O4/c1-33(18-6-4-3-5-13-27(34)32-36)28(35)21-14-16-22(17-15-21)29(37-2,23-9-7-11-25(30)19-23)24-10-8-12-26(31)20-24/h7-12,14-17,19-20,36H,3-6,13,18H2,1-2H3,(H,32,34) |
| InChIKey | HKWZWUVMLKEMRP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|