C14H15N5O — CID 58558107
piperidin-1-yl(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)methanone (PubChem CID 58558107) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is piperidin-1-yl(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)methanone.
| Compound Name | piperidin-1-yl(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)methanone |
|---|---|
| PubChem CID | 58558107 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | piperidin-1-yl(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)methanone |
| SMILES | O=C(c1cnc2cnc3[nH]ccc3n12)N1CCCCC1 |
| InChI | InChI=1S/C14H15N5O/c20-14(18-6-2-1-3-7-18)11-8-16-12-9-17-13-10(19(11)12)4-5-15-13/h4-5,8-9,15H,1-3,6-7H2 |
| InChIKey | NHSZYKMIOONWHM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |