C13H15N5 — CID 67216754
12-[(3S)-piperidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 67216754) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 12-[(3S)-piperidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-[(3S)-piperidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 67216754 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 12-[(3S)-piperidin-3-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | c1cc2c(ncc3ncc([C@H]4CCCNC4)n32)[nH]1 |
| InChI | InChI=1S/C13H15N5/c1-2-9(6-14-4-1)11-7-16-12-8-17-13-10(18(11)12)3-5-15-13/h3,5,7-9,14-15H,1-2,4,6H2/t9-/m0/s1 |
| InChIKey | PJXZEBXTLVNONK-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |