C14H16N4Nb — CID 156847096
12-[(3S)-3-methanidylpentan-2-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;niobium(2+) (PubChem CID 156847096) has the molecular formula C14H16N4Nb and a molecular weight of 333.22 g/mol. Its IUPAC name is 12-[(3S)-3-methanidylpentan-2-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;niobium(2+).
| Compound Name | 12-[(3S)-3-methanidylpentan-2-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;niobium(2+) |
|---|---|
| PubChem CID | 156847096 |
| Molecular Formula | C14H16N4Nb |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 12-[(3S)-3-methanidylpentan-2-yl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;niobium(2+) |
| SMILES | [CH2-]C(c1cnc2cnc3[nH]ccc3n12)[C@@H]([CH2-])CC.[Nb+2] |
| InChI | InChI=1S/C14H16N4.Nb/c1-4-9(2)10(3)12-7-16-13-8-17-14-11(18(12)13)5-6-15-14;/h5-10,15H,2-4H2,1H3;/q-2;+2/t9-,10?;/m0./s1 |
| InChIKey | AQOPMHJYIIIHRA-KKFCBZOWSA-N |
| XLogP | 2.99 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|