C34H28N6 — CID 58559699
2-[(E)-3-[benzyl-[[3-[[benzyl-[(1E,3E)-4-cyano-4-isocyanobuta-1,3-dienyl]amino]methyl]phenyl]methyl]amino]prop-2-enylidene]propanedinitrile (PubChem CID 58559699) has the molecular formula C34H28N6 and a molecular weight of 520.64 g/mol. Its IUPAC name is 2-[(E)-3-[benzyl-[[3-[[benzyl-[(1E,3E)-4-cyano-4-isocyanobuta-1,3-dienyl]amino]methyl]phenyl]methyl]amino]prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-3-[benzyl-[[3-[[benzyl-[(1E,3E)-4-cyano-4-isocyanobuta-1,3-dienyl]amino]methyl]phenyl]methyl]amino]prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 58559699 |
| Molecular Formula | C34H28N6 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[(E)-3-[benzyl-[[3-[[benzyl-[(1E,3E)-4-cyano-4-isocyanobuta-1,3-dienyl]amino]methyl]phenyl]methyl]amino]prop-2-enylidene]propanedinitrile |
| SMILES | [C-]#[N+]/C(C#N)=C/C=C/N(Cc1ccccc1)Cc1cccc(CN(/C=C/C=C(C#N)C#N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H28N6/c1-38-34(24-37)18-10-20-40(26-30-13-6-3-7-14-30)28-32-16-8-15-31(21-32)27-39(19-9-17-33(22-35)23-36)25-29-11-4-2-5-12-29/h2-21H,25-28H2/b19-9+,20-10+,34-18+ |
| InChIKey | OJUFVIIPMITTOC-AHBOBKCSSA-N |
| XLogP | 7.02 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|