C14H14F4O4 — CID 585632
(4-butanoylphenyl) 2,3,3,3-tetrafluoro-2-methoxypropanoate (PubChem CID 585632) has the molecular formula C14H14F4O4 and a molecular weight of 322.25 g/mol. Its IUPAC name is (4-butanoylphenyl) 2,3,3,3-tetrafluoro-2-methoxypropanoate.
| Compound Name | (4-butanoylphenyl) 2,3,3,3-tetrafluoro-2-methoxypropanoate |
|---|---|
| PubChem CID | 585632 |
| Molecular Formula | C14H14F4O4 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (4-butanoylphenyl) 2,3,3,3-tetrafluoro-2-methoxypropanoate |
| SMILES | CCCC(=O)c1ccc(OC(=O)C(F)(OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F4O4/c1-3-4-11(19)9-5-7-10(8-6-9)22-12(20)13(15,21-2)14(16,17)18/h5-8H,3-4H2,1-2H3 |
| InChIKey | JSHRYALWADGWMI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|