C45H56O6 — CID 58571424
1-O-[3-[4-[(3,4-dimethylphenyl)-(4-phenylphenyl)methyl]phenyl]propyl] 5-O-[2-(2-ethoxyethoxy)ethyl] 4-methyl-2-propan-2-ylpentanedioate (PubChem CID 58571424) has the molecular formula C45H56O6 and a molecular weight of 692.94 g/mol. Its IUPAC name is 1-O-[3-[4-[(3,4-dimethylphenyl)-(4-phenylphenyl)methyl]phenyl]propyl] 5-O-[2-(2-ethoxyethoxy)ethyl] 4-methyl-2-propan-2-ylpentanedioate.
| Compound Name | 1-O-[3-[4-[(3,4-dimethylphenyl)-(4-phenylphenyl)methyl]phenyl]propyl] 5-O-[2-(2-ethoxyethoxy)ethyl] 4-methyl-2-propan-2-ylpentanedioate |
|---|---|
| PubChem CID | 58571424 |
| Molecular Formula | C45H56O6 |
| Molecular Weight | 692.94 g/mol |
| Exact Mass | 692.41 |
| IUPAC Name | 1-O-[3-[4-[(3,4-dimethylphenyl)-(4-phenylphenyl)methyl]phenyl]propyl] 5-O-[2-(2-ethoxyethoxy)ethyl] 4-methyl-2-propan-2-ylpentanedioate |
| SMILES | CCOCCOCCOC(=O)C(C)CC(C(=O)OCCCc1ccc(C(c2ccc(-c3ccccc3)cc2)c2ccc(C)c(C)c2)cc1)C(C)C |
| InChI | InChI=1S/C45H56O6/c1-7-48-26-27-49-28-29-51-44(46)35(6)31-42(32(2)3)45(47)50-25-11-12-36-16-19-39(20-17-36)43(41-18-15-33(4)34(5)30-41)40-23-21-38(22-24-40)37-13-9-8-10-14-37/h8-10,13-24,30,32,35,42-43H,7,11-12,25-29,31H2,1-6H3 |
| InChIKey | CRARXJXKISBMRU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.94 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|