C23H21F9NO12S4- — CID 58571923
[3-[4-[2-(4-butan-2-ylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 58571923) has the molecular formula C23H21F9NO12S4- and a molecular weight of 802.67 g/mol. Its IUPAC name is [3-[4-[2-(4-butan-2-ylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [3-[4-[2-(4-butan-2-ylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 58571923 |
| Molecular Formula | C23H21F9NO12S4- |
| Molecular Weight | 802.67 g/mol |
| Exact Mass | 801.98 |
| IUPAC Name | [3-[4-[2-(4-butan-2-ylphenoxy)sulfonylethoxycarbonyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(C)c1ccc(OS(=O)(=O)CCOC(=O)c2ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H21F9NO12S4/c1-3-14(2)15-4-8-17(9-5-15)44-46(35,36)13-12-43-19(34)16-6-10-18(11-7-16)45-49(41,42)22(28,29)20(24,25)21(26,27)47(37,38)33-48(39,40)23(30,31)32/h4-11,14H,3,12-13H2,1-2H3/q-1 |
| InChIKey | YLZMLDHBBYNVJS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 195.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|