C22H31N — CID 58581915
3-(3-methylcyclohexyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine (PubChem CID 58581915) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-(3-methylcyclohexyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine.
| Compound Name | 3-(3-methylcyclohexyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 58581915 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 3-(3-methylcyclohexyl)-N-[(1R)-1-naphthalen-1-ylethyl]propan-1-amine |
| SMILES | CC1CCCC(CCCN[C@H](C)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C22H31N/c1-17-8-5-9-19(16-17)10-7-15-23-18(2)21-14-6-12-20-11-3-4-13-22(20)21/h3-4,6,11-14,17-19,23H,5,7-10,15-16H2,1-2H3/t17?,18-,19?/m1/s1 |
| InChIKey | HAUABQXISJDTDR-JLAWEPINSA-N |
| XLogP | 6.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|