C21H19Cl2NO8S2 — CID 58594591
(3S)-3-[[3-(acetylsulfanylmethyl)phenyl]sulfonylamino]-5-(2,6-dichlorobenzoyl)oxy-4-oxopentanoic acid (PubChem CID 58594591) has the molecular formula C21H19Cl2NO8S2 and a molecular weight of 548.42 g/mol. Its IUPAC name is (3S)-3-[[3-(acetylsulfanylmethyl)phenyl]sulfonylamino]-5-(2,6-dichlorobenzoyl)oxy-4-oxopentanoic acid.
| Compound Name | (3S)-3-[[3-(acetylsulfanylmethyl)phenyl]sulfonylamino]-5-(2,6-dichlorobenzoyl)oxy-4-oxopentanoic acid |
|---|---|
| PubChem CID | 58594591 |
| Molecular Formula | C21H19Cl2NO8S2 |
| Molecular Weight | 548.42 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | (3S)-3-[[3-(acetylsulfanylmethyl)phenyl]sulfonylamino]-5-(2,6-dichlorobenzoyl)oxy-4-oxopentanoic acid |
| SMILES | CC(=O)SCc1cccc(S(=O)(=O)N[C@@H](CC(=O)O)C(=O)COC(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C21H19Cl2NO8S2/c1-12(25)33-11-13-4-2-5-14(8-13)34(30,31)24-17(9-19(27)28)18(26)10-32-21(29)20-15(22)6-3-7-16(20)23/h2-8,17,24H,9-11H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | OPAOZXMHFOZPBO-KRWDZBQOSA-N |
| XLogP | 3.32 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|