C8H15BN2O3 — CID 58595488
[(6S)-6-methoxycarbonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylborinic acid (PubChem CID 58595488) has the molecular formula C8H15BN2O3 and a molecular weight of 198.03 g/mol. Its IUPAC name is [(6S)-6-methoxycarbonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylborinic acid.
| Compound Name | [(6S)-6-methoxycarbonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58595488 |
| Molecular Formula | C8H15BN2O3 |
| Molecular Weight | 198.03 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | [(6S)-6-methoxycarbonyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylborinic acid |
| SMILES | COC(=O)[C@H]1NC2CC1N(B(C)O)C2 |
| InChI | InChI=1S/C8H15BN2O3/c1-9(13)11-4-5-3-6(11)7(10-5)8(12)14-2/h5-7,10,13H,3-4H2,1-2H3/t5?,6?,7-/m0/s1 |
| InChIKey | XYEROCCHBDVZLF-AHXFUIDQSA-N |
| XLogP | -1.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.03 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|